C29H31FN4O2 — CID 121442279
2-ethyl-N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 121442279) has the molecular formula C29H31FN4O2 and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-ethyl-N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121442279 |
| Molecular Formula | C29H31FN4O2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-ethyl-N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(OC)cn2c1C(=O)NCc1ccc(N2CCC(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H31FN4O2/c1-3-26-28(34-19-25(36-2)12-13-27(34)32-26)29(35)31-18-20-4-10-24(11-5-20)33-16-14-22(15-17-33)21-6-8-23(30)9-7-21/h4-13,19,22H,3,14-18H2,1-2H3,(H,31,35) |
| InChIKey | FWIDBMDOZVUVLG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|