C28H30ClN5O2 — CID 121442204
N-[[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]methyl]-2-ethyl-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 121442204) has the molecular formula C28H30ClN5O2 and a molecular weight of 504.03 g/mol. Its IUPAC name is N-[[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]methyl]-2-ethyl-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]methyl]-2-ethyl-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121442204 |
| Molecular Formula | C28H30ClN5O2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | N-[[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]methyl]-2-ethyl-6-methoxyimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(OC)cn2c1C(=O)NCc1ccc(N2CCN(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H30ClN5O2/c1-3-25-27(34-19-24(36-2)12-13-26(34)31-25)28(35)30-18-20-4-8-22(9-5-20)32-14-16-33(17-15-32)23-10-6-21(29)7-11-23/h4-13,19H,3,14-18H2,1-2H3,(H,30,35) |
| InChIKey | PNMADPHCXJZSNE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|