C28H36ClN5O — CID 155533904
6-chloro-N-[[4-[4-(cyclohexylmethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 155533904) has the molecular formula C28H36ClN5O and a molecular weight of 494.08 g/mol. Its IUPAC name is 6-chloro-N-[[4-[4-(cyclohexylmethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[[4-[4-(cyclohexylmethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155533904 |
| Molecular Formula | C28H36ClN5O |
| Molecular Weight | 494.08 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 6-chloro-N-[[4-[4-(cyclohexylmethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(Cl)cn2c1C(=O)NCc1ccc(N2CCN(CC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C28H36ClN5O/c1-2-25-27(34-20-23(29)10-13-26(34)31-25)28(35)30-18-21-8-11-24(12-9-21)33-16-14-32(15-17-33)19-22-6-4-3-5-7-22/h8-13,20,22H,2-7,14-19H2,1H3,(H,30,35) |
| InChIKey | NNXTUAUQXQVDHA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.08 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|