C28H29F3N5OP — CID 144782840
2-ethyl-N-[[4-[4-(4-phosphanylphenyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 144782840) has the molecular formula C28H29F3N5OP and a molecular weight of 539.54 g/mol. Its IUPAC name is 2-ethyl-N-[[4-[4-(4-phosphanylphenyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[4-[4-(4-phosphanylphenyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144782840 |
| Molecular Formula | C28H29F3N5OP |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-ethyl-N-[[4-[4-(4-phosphanylphenyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(C(F)(F)F)cn2c1C(=O)NCc1ccc(N2CCN(c3ccc(P)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H29F3N5OP/c1-2-24-26(36-18-20(28(29,30)31)5-12-25(36)33-24)27(37)32-17-19-3-6-21(7-4-19)34-13-15-35(16-14-34)22-8-10-23(38)11-9-22/h3-12,18H,2,13-17,38H2,1H3,(H,32,37) |
| InChIKey | QVTRACVZIZVCFK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|