C29H29BrF3N5O2 — CID 141476292
6-bromo-2-ethyl-N-[2-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenoxy]ethyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 141476292) has the molecular formula C29H29BrF3N5O2 and a molecular weight of 616.48 g/mol. Its IUPAC name is 6-bromo-2-ethyl-N-[2-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenoxy]ethyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-bromo-2-ethyl-N-[2-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenoxy]ethyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141476292 |
| Molecular Formula | C29H29BrF3N5O2 |
| Molecular Weight | 616.48 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | 6-bromo-2-ethyl-N-[2-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenoxy]ethyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(Br)cn2c1C(=O)NCCOc1ccc(N2CCN(c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H29BrF3N5O2/c1-2-25-27(38-19-21(30)5-12-26(38)35-25)28(39)34-13-18-40-24-10-8-23(9-11-24)37-16-14-36(15-17-37)22-6-3-20(4-7-22)29(31,32)33/h3-12,19H,2,13-18H2,1H3,(H,34,39) |
| InChIKey | NQQXOZCJTSOCAK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|