C30H34FN4O2P — CID 166657384
2-ethyl-N-[[4-[4-[4-[fluoro(phosphanyl)methoxy]phenyl]piperidin-1-yl]phenyl]methyl]-6-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 166657384) has the molecular formula C30H34FN4O2P and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-ethyl-N-[[4-[4-[4-[fluoro(phosphanyl)methoxy]phenyl]piperidin-1-yl]phenyl]methyl]-6-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[4-[4-[4-[fluoro(phosphanyl)methoxy]phenyl]piperidin-1-yl]phenyl]methyl]-6-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166657384 |
| Molecular Formula | C30H34FN4O2P |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2-ethyl-N-[[4-[4-[4-[fluoro(phosphanyl)methoxy]phenyl]piperidin-1-yl]phenyl]methyl]-6-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(C)cn2c1C(=O)NCc1ccc(N2CCC(c3ccc(OC(F)P)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H34FN4O2P/c1-3-26-28(35-19-20(2)4-13-27(35)33-26)29(36)32-18-21-5-9-24(10-6-21)34-16-14-23(15-17-34)22-7-11-25(12-8-22)37-30(31)38/h4-13,19,23,30H,3,14-18,38H2,1-2H3,(H,32,36) |
| InChIKey | QSASEORKZGZHJX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|