C27H26Cl2N4O2 — CID 121442375
6-chloro-N-[[4-[(3R)-3-(4-chlorophenoxy)pyrrolidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 121442375) has the molecular formula C27H26Cl2N4O2 and a molecular weight of 509.44 g/mol. Its IUPAC name is 6-chloro-N-[[4-[(3R)-3-(4-chlorophenoxy)pyrrolidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[[4-[(3R)-3-(4-chlorophenoxy)pyrrolidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121442375 |
| Molecular Formula | C27H26Cl2N4O2 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 6-chloro-N-[[4-[(3R)-3-(4-chlorophenoxy)pyrrolidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(Cl)cn2c1C(=O)NCc1ccc(N2CC[C@@H](Oc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C27H26Cl2N4O2/c1-2-24-26(33-16-20(29)7-12-25(33)31-24)27(34)30-15-18-3-8-21(9-4-18)32-14-13-23(17-32)35-22-10-5-19(28)6-11-22/h3-12,16,23H,2,13-15,17H2,1H3,(H,30,34)/t23-/m1/s1 |
| InChIKey | PYMZOKMZTBYCNM-HSZRJFAPSA-N |
| XLogP | 5.79 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|