C28H28ClFN4O2 — CID 53466679
7-chloro-2-ethyl-N-[[4-[4-(4-fluorophenoxy)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 53466679) has the molecular formula C28H28ClFN4O2 and a molecular weight of 507.01 g/mol. Its IUPAC name is 7-chloro-2-ethyl-N-[[4-[4-(4-fluorophenoxy)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 7-chloro-2-ethyl-N-[[4-[4-(4-fluorophenoxy)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53466679 |
| Molecular Formula | C28H28ClFN4O2 |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 7-chloro-2-ethyl-N-[[4-[4-(4-fluorophenoxy)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2cc(Cl)ccn2c1C(=O)NCc1ccc(N2CCC(Oc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H28ClFN4O2/c1-2-25-27(34-16-11-20(29)17-26(34)32-25)28(35)31-18-19-3-7-22(8-4-19)33-14-12-24(13-15-33)36-23-9-5-21(30)6-10-23/h3-11,16-17,24H,2,12-15,18H2,1H3,(H,31,35) |
| InChIKey | RBNWUHDRNSIEKE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|