C21H23ClFN5O — CID 135194020
6-chloro-2-ethyl-N-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide (PubChem CID 135194020) has the molecular formula C21H23ClFN5O and a molecular weight of 415.90 g/mol. Its IUPAC name is 6-chloro-2-ethyl-N-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 6-chloro-2-ethyl-N-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 135194020 |
| Molecular Formula | C21H23ClFN5O |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 6-chloro-2-ethyl-N-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCc1nc2ncc(Cl)cn2c1C(=O)NCc1ccc(N2CCC(F)CC2)cc1 |
| InChI | InChI=1S/C21H23ClFN5O/c1-2-18-19(28-13-15(22)12-25-21(28)26-18)20(29)24-11-14-3-5-17(6-4-14)27-9-7-16(23)8-10-27/h3-6,12-13,16H,2,7-11H2,1H3,(H,24,29) |
| InChIKey | HMGXNXIJEMNBSZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|