C28H29FN4O2 — CID 121442365
N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxy-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 121442365) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxy-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxy-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121442365 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | N-[[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methyl]-6-methoxy-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | COc1ccc2nc(C)c(C(=O)NCc3ccc(N4CCC(c5ccc(F)cc5)CC4)cc3)n2c1 |
| InChI | InChI=1S/C28H29FN4O2/c1-19-27(33-18-25(35-2)11-12-26(33)31-19)28(34)30-17-20-3-9-24(10-4-20)32-15-13-22(14-16-32)21-5-7-23(29)8-6-21/h3-12,18,22H,13-17H2,1-2H3,(H,30,34) |
| InChIKey | ROKVUHFYOVVXHG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|