C13H19FN2O3S — CID 71050351
(1R,2S)-2-amino-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-fluoropropan-1-ol (PubChem CID 71050351) has the molecular formula C13H19FN2O3S and a molecular weight of 302.37 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-fluoropropan-1-ol.
| Compound Name | (1R,2S)-2-amino-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-fluoropropan-1-ol |
|---|---|
| PubChem CID | 71050351 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (1R,2S)-2-amino-1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-fluoropropan-1-ol |
| SMILES | N[C@H](CF)[C@H](O)c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H19FN2O3S/c14-9-12(15)13(17)10-1-3-11(4-2-10)16-5-7-20(18,19)8-6-16/h1-4,12-13,17H,5-9,15H2/t12-,13-/m1/s1 |
| InChIKey | QOUJHHPFLFSSOO-CHWSQXEVSA-N |
| XLogP | 0.25 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|