C14H20FNO2S — CID 71050083
(1R,2S)-2-amino-3-fluoro-1-[4-(1-oxothian-4-yl)phenyl]propan-1-ol (PubChem CID 71050083) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is (1R,2S)-2-amino-3-fluoro-1-[4-(1-oxothian-4-yl)phenyl]propan-1-ol.
| Compound Name | (1R,2S)-2-amino-3-fluoro-1-[4-(1-oxothian-4-yl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 71050083 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (1R,2S)-2-amino-3-fluoro-1-[4-(1-oxothian-4-yl)phenyl]propan-1-ol |
| SMILES | N[C@H](CF)[C@H](O)c1ccc(C2CCS(=O)CC2)cc1 |
| InChI | InChI=1S/C14H20FNO2S/c15-9-13(16)14(17)12-3-1-10(2-4-12)11-5-7-19(18)8-6-11/h1-4,11,13-14,17H,5-9,16H2/t11?,13-,14-,19?/m1/s1 |
| InChIKey | ZBSQLAQIHXTINR-MAKZOEPASA-N |
| XLogP | 1.64 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |