C12H16N2O2S — CID 171514731
1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanimine (PubChem CID 171514731) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanimine.
| Compound Name | 1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanimine |
|---|---|
| PubChem CID | 171514731 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methylmethanimine |
| SMILES | C/N=C/c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C12H16N2O2S/c1-13-10-11-2-4-12(5-3-11)14-6-8-17(15,16)9-7-14/h2-5,10H,6-9H2,1H3/b13-10+ |
| InChIKey | WWTSOADJNCIJKP-JLHYYAGUSA-N |
| XLogP | 0.97 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|