C20H18N2O4S — CID 90987422
2-cyano-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]phenyl]prop-2-enoic acid (PubChem CID 90987422) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-cyano-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90987422 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-cyano-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]phenyl]prop-2-enoic acid |
| SMILES | N#CC(=Cc1ccc(-c2ccc(N3CCS(=O)(=O)CC3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H18N2O4S/c21-14-18(20(23)24)13-15-1-3-16(4-2-15)17-5-7-19(8-6-17)22-9-11-27(25,26)12-10-22/h1-8,13H,9-12H2,(H,23,24) |
| InChIKey | SZKOQCNFOBXSBP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|