C21H22N2O4S — CID 91566436
2-cyano-2-[3-[2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid (PubChem CID 91566436) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-cyano-2-[3-[2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid.
| Compound Name | 2-cyano-2-[3-[2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid |
|---|---|
| PubChem CID | 91566436 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-cyano-2-[3-[2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid |
| SMILES | N#CC(C(=O)O)=C1C=C(C=Cc2ccc(N3CCS(=O)(=O)CC3)cc2)CCC1 |
| InChI | InChI=1S/C21H22N2O4S/c22-15-20(21(24)25)18-3-1-2-17(14-18)5-4-16-6-8-19(9-7-16)23-10-12-28(26,27)13-11-23/h4-9,14H,1-3,10-13H2,(H,24,25) |
| InChIKey | MPBCMBVDTLTPMG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|