C21H20N2O — CID 3977368
2-benzoyl-3-(4-piperidin-1-ylphenyl)prop-2-enenitrile (PubChem CID 3977368) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-benzoyl-3-(4-piperidin-1-ylphenyl)prop-2-enenitrile.
| Compound Name | 2-benzoyl-3-(4-piperidin-1-ylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3977368 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-benzoyl-3-(4-piperidin-1-ylphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(N2CCCCC2)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O/c22-16-19(21(24)18-7-3-1-4-8-18)15-17-9-11-20(12-10-17)23-13-5-2-6-14-23/h1,3-4,7-12,15H,2,5-6,13-14H2 |
| InChIKey | BDLDQNZJMMKSBD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|