C38H40N6O2 — CID 25017804
(Z)-2-cyano-N-[[3-[[[(Z)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 25017804) has the molecular formula C38H40N6O2 and a molecular weight of 612.78 g/mol. Its IUPAC name is (Z)-2-cyano-N-[[3-[[[(Z)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[[3-[[[(Z)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 25017804 |
| Molecular Formula | C38H40N6O2 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | (Z)-2-cyano-N-[[3-[[[(Z)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(N2CCCCC2)cc1)C(=O)NCc1cccc(CNC(=O)/C(C#N)=C\c2ccc(N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C38H40N6O2/c39-25-33(23-29-10-14-35(15-11-29)43-18-3-1-4-19-43)37(45)41-27-31-8-7-9-32(22-31)28-42-38(46)34(26-40)24-30-12-16-36(17-13-30)44-20-5-2-6-21-44/h7-17,22-24H,1-6,18-21,27-28H2,(H,41,45)(H,42,46)/b33-23-,34-24- |
| InChIKey | QBMNPGSYEZNBBC-DQWRGTGXSA-N |
| XLogP | 6.11 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|