C16H19N3O — CID 26477461
(Z)-2-cyano-N-methyl-3-(4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 26477461) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (Z)-2-cyano-N-methyl-3-(4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-methyl-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26477461 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (Z)-2-cyano-N-methyl-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | CNC(=O)/C(C#N)=C\c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H19N3O/c1-18-16(20)14(12-17)11-13-5-7-15(8-6-13)19-9-3-2-4-10-19/h5-8,11H,2-4,9-10H2,1H3,(H,18,20)/b14-11- |
| InChIKey | WDFWURVIJKNJCU-KAMYIIQDSA-N |
| XLogP | 2.33 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|