C25H29N3O — CID 91595409
2-cyano-N-[(1S)-1-phenylbutyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 91595409) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-cyano-N-[(1S)-1-phenylbutyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-[(1S)-1-phenylbutyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91595409 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-cyano-N-[(1S)-1-phenylbutyl]-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | CCC[C@H](NC(=O)C(C#N)=Cc1ccc(N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O/c1-2-9-24(21-10-5-3-6-11-21)27-25(29)22(19-26)18-20-12-14-23(15-13-20)28-16-7-4-8-17-28/h3,5-6,10-15,18,24H,2,4,7-9,16-17H2,1H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | PZZIJTDKJSODGF-DEOSSOPVSA-N |
| XLogP | 5.24 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|