C18H18N2OS — CID 59578751
(E)-2-cyano-N-[(1S)-1-phenylbutyl]-3-thiophen-3-ylprop-2-enamide (PubChem CID 59578751) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1S)-1-phenylbutyl]-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1S)-1-phenylbutyl]-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 59578751 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (E)-2-cyano-N-[(1S)-1-phenylbutyl]-3-thiophen-3-ylprop-2-enamide |
| SMILES | CCC[C@H](NC(=O)/C(C#N)=C/c1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2OS/c1-2-6-17(15-7-4-3-5-8-15)20-18(21)16(12-19)11-14-9-10-22-13-14/h3-5,7-11,13,17H,2,6H2,1H3,(H,20,21)/b16-11+/t17-/m0/s1 |
| InChIKey | QSRTVICSVHNIEE-YTBHAWNYSA-N |
| XLogP | 4.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|