C19H18IN3O — CID 88571631
(E)-2-cyano-3-(6-iodo-2-pyridinyl)-N-[(1S)-1-phenylbutyl]prop-2-enamide (PubChem CID 88571631) has the molecular formula C19H18IN3O and a molecular weight of 431.28 g/mol. Its IUPAC name is (E)-2-cyano-3-(6-iodo-2-pyridinyl)-N-[(1S)-1-phenylbutyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(6-iodo-2-pyridinyl)-N-[(1S)-1-phenylbutyl]prop-2-enamide |
|---|---|
| PubChem CID | 88571631 |
| Molecular Formula | C19H18IN3O |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | (E)-2-cyano-3-(6-iodo-2-pyridinyl)-N-[(1S)-1-phenylbutyl]prop-2-enamide |
| SMILES | CCC[C@H](NC(=O)/C(C#N)=C/c1cccc(I)n1)c1ccccc1 |
| InChI | InChI=1S/C19H18IN3O/c1-2-7-17(14-8-4-3-5-9-14)23-19(24)15(13-21)12-16-10-6-11-18(20)22-16/h3-6,8-12,17H,2,7H2,1H3,(H,23,24)/b15-12+/t17-/m0/s1 |
| InChIKey | GYRHDUPWQSGLBQ-VMEIHUARSA-N |
| XLogP | 4.25 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|