C17H17N5O — CID 56947534
(E)-2-cyano-N-(1-phenylbutyl)-3-(1,3,5-triazin-2-yl)prop-2-enamide (PubChem CID 56947534) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is (E)-2-cyano-N-(1-phenylbutyl)-3-(1,3,5-triazin-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1-phenylbutyl)-3-(1,3,5-triazin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 56947534 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (E)-2-cyano-N-(1-phenylbutyl)-3-(1,3,5-triazin-2-yl)prop-2-enamide |
| SMILES | CCCC(NC(=O)/C(C#N)=C/c1ncncn1)c1ccccc1 |
| InChI | InChI=1S/C17H17N5O/c1-2-6-15(13-7-4-3-5-8-13)22-17(23)14(10-18)9-16-20-11-19-12-21-16/h3-5,7-9,11-12,15H,2,6H2,1H3,(H,22,23)/b14-9+ |
| InChIKey | MWFNWAFZLVIZJG-NTEUORMPSA-N |
| XLogP | 2.44 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|