C21H20ClFN2O — CID 91453719
3-(6-chloro-2-fluoro-3-methylphenyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide (PubChem CID 91453719) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is 3-(6-chloro-2-fluoro-3-methylphenyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide.
| Compound Name | 3-(6-chloro-2-fluoro-3-methylphenyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide |
|---|---|
| PubChem CID | 91453719 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3-(6-chloro-2-fluoro-3-methylphenyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide |
| SMILES | CCC[C@H](NC(=O)C(C#N)=Cc1c(Cl)ccc(C)c1F)c1ccccc1 |
| InChI | InChI=1S/C21H20ClFN2O/c1-3-7-19(15-8-5-4-6-9-15)25-21(26)16(13-24)12-17-18(22)11-10-14(2)20(17)23/h4-6,8-12,19H,3,7H2,1-2H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | OKBRICQZJBHPPW-IBGZPJMESA-N |
| XLogP | 5.35 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|