C23H20ClN3O — CID 122462003
(E)-3-(8-chloroquinolin-2-yl)-2-cyano-N-(1-phenylbutyl)prop-2-enamide (PubChem CID 122462003) has the molecular formula C23H20ClN3O and a molecular weight of 389.89 g/mol. Its IUPAC name is (E)-3-(8-chloroquinolin-2-yl)-2-cyano-N-(1-phenylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(8-chloroquinolin-2-yl)-2-cyano-N-(1-phenylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 122462003 |
| Molecular Formula | C23H20ClN3O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (E)-3-(8-chloroquinolin-2-yl)-2-cyano-N-(1-phenylbutyl)prop-2-enamide |
| SMILES | CCCC(NC(=O)/C(C#N)=C/c1ccc2cccc(Cl)c2n1)c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O/c1-2-7-21(16-8-4-3-5-9-16)27-23(28)18(15-25)14-19-13-12-17-10-6-11-20(24)22(17)26-19/h3-6,8-14,21H,2,7H2,1H3,(H,27,28)/b18-14+ |
| InChIKey | NRDUIGWJAOKTKS-NBVRZTHBSA-N |
| XLogP | 5.45 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|