C19H22BrN3OS — CID 160654780
(E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylpropyl]prop-2-enamide;methane;sulfane (PubChem CID 160654780) has the molecular formula C19H22BrN3OS and a molecular weight of 420.38 g/mol. Its IUPAC name is (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylpropyl]prop-2-enamide;methane;sulfane.
| Compound Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylpropyl]prop-2-enamide;methane;sulfane |
|---|---|
| PubChem CID | 160654780 |
| Molecular Formula | C19H22BrN3OS |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylpropyl]prop-2-enamide;methane;sulfane |
| SMILES | C.CC[C@H](NC(=O)/C(C#N)=C/c1cccc(Br)n1)c1ccccc1.S |
| InChI | InChI=1S/C18H16BrN3O.CH4.H2S/c1-2-16(13-7-4-3-5-8-13)22-18(23)14(12-20)11-15-9-6-10-17(19)21-15;;/h3-11,16H,2H2,1H3,(H,22,23);1H4;1H2/b14-11+;;/t16-;;/m0../s1 |
| InChIKey | RKXAINWSKMLZLX-PEABKSMSSA-N |
| XLogP | 4.77 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|