C17H15BrN4O — CID 91226676
N-[(1S)-1-(2-aminophenyl)ethyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide (PubChem CID 91226676) has the molecular formula C17H15BrN4O and a molecular weight of 371.24 g/mol. Its IUPAC name is N-[(1S)-1-(2-aminophenyl)ethyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide.
| Compound Name | N-[(1S)-1-(2-aminophenyl)ethyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 91226676 |
| Molecular Formula | C17H15BrN4O |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-[(1S)-1-(2-aminophenyl)ethyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide |
| SMILES | C[C@H](NC(=O)C(C#N)=Cc1cccc(Br)n1)c1ccccc1N |
| InChI | InChI=1S/C17H15BrN4O/c1-11(14-6-2-3-7-15(14)20)21-17(23)12(10-19)9-13-5-4-8-16(18)22-13/h2-9,11H,20H2,1H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | FIBUVYQTELHNFP-NSHDSACASA-N |
| XLogP | 3.21 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|