C31H22BrN3O4 — CID 59578749
[2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 4-benzoylbenzoate (PubChem CID 59578749) has the molecular formula C31H22BrN3O4 and a molecular weight of 580.44 g/mol. Its IUPAC name is [2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 4-benzoylbenzoate.
| Compound Name | [2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 59578749 |
| Molecular Formula | C31H22BrN3O4 |
| Molecular Weight | 580.44 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | [2-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-2-phenylethyl] 4-benzoylbenzoate |
| SMILES | N#C/C(=C\c1cccc(Br)n1)C(=O)NC(COC(=O)c1ccc(C(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H22BrN3O4/c32-28-13-7-12-26(34-28)18-25(19-33)30(37)35-27(21-8-3-1-4-9-21)20-39-31(38)24-16-14-23(15-17-24)29(36)22-10-5-2-6-11-22/h1-18,27H,20H2,(H,35,37)/b25-18+ |
| InChIKey | UONXDKXEZOJPNJ-XIEYBQDHSA-N |
| XLogP | 5.70 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|