C18H16BrN3O — CID 90986007
3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-(4-methylphenyl)ethyl]prop-2-enamide (PubChem CID 90986007) has the molecular formula C18H16BrN3O and a molecular weight of 370.25 g/mol. Its IUPAC name is 3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-(4-methylphenyl)ethyl]prop-2-enamide.
| Compound Name | 3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-(4-methylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 90986007 |
| Molecular Formula | C18H16BrN3O |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-(4-methylphenyl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)C(C#N)=Cc2cccc(Br)n2)cc1 |
| InChI | InChI=1S/C18H16BrN3O/c1-12-6-8-14(9-7-12)13(2)21-18(23)15(11-20)10-16-4-3-5-17(19)22-16/h3-10,13H,1-2H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | OAWUFRMBQHLVLJ-ZDUSSCGKSA-N |
| XLogP | 3.94 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|