C19H18BrN3O — CID 143552857
(E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(2E)-1-cyclopropyl-2-ethenylpenta-2,4-dienyl]prop-2-enamide (PubChem CID 143552857) has the molecular formula C19H18BrN3O and a molecular weight of 384.28 g/mol. Its IUPAC name is (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(2E)-1-cyclopropyl-2-ethenylpenta-2,4-dienyl]prop-2-enamide.
| Compound Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(2E)-1-cyclopropyl-2-ethenylpenta-2,4-dienyl]prop-2-enamide |
|---|---|
| PubChem CID | 143552857 |
| Molecular Formula | C19H18BrN3O |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(2E)-1-cyclopropyl-2-ethenylpenta-2,4-dienyl]prop-2-enamide |
| SMILES | C=C/C=C(\C=C)C(NC(=O)/C(C#N)=C/c1cccc(Br)n1)C1CC1 |
| InChI | InChI=1S/C19H18BrN3O/c1-3-6-13(4-2)18(14-9-10-14)23-19(24)15(12-21)11-16-7-5-8-17(20)22-16/h3-8,11,14,18H,1-2,9-10H2,(H,23,24)/b13-6+,15-11+ |
| InChIKey | YXBBUXVESYDAFU-BLROPFBQSA-N |
| XLogP | 3.94 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|