C16H13BrN4O — CID 24992579
(Z)-N-[(3-aminophenyl)methyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide (PubChem CID 24992579) has the molecular formula C16H13BrN4O and a molecular weight of 357.21 g/mol. Its IUPAC name is (Z)-N-[(3-aminophenyl)methyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-[(3-aminophenyl)methyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 24992579 |
| Molecular Formula | C16H13BrN4O |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (Z)-N-[(3-aminophenyl)methyl]-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1cccc(Br)n1)C(=O)NCc1cccc(N)c1 |
| InChI | InChI=1S/C16H13BrN4O/c17-15-6-2-5-14(21-15)8-12(9-18)16(22)20-10-11-3-1-4-13(19)7-11/h1-8H,10,19H2,(H,20,22)/b12-8- |
| InChIKey | VDMGFULTLWDGCZ-WQLSENKSSA-N |
| XLogP | 2.65 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|