C19H18BrN3O2 — CID 87170255
3-(6-bromo-2-pyridinyl)-2-cyano-N-[4-(4-hydroxyphenyl)butyl]prop-2-enamide (PubChem CID 87170255) has the molecular formula C19H18BrN3O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is 3-(6-bromo-2-pyridinyl)-2-cyano-N-[4-(4-hydroxyphenyl)butyl]prop-2-enamide.
| Compound Name | 3-(6-bromo-2-pyridinyl)-2-cyano-N-[4-(4-hydroxyphenyl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 87170255 |
| Molecular Formula | C19H18BrN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 3-(6-bromo-2-pyridinyl)-2-cyano-N-[4-(4-hydroxyphenyl)butyl]prop-2-enamide |
| SMILES | N#CC(=Cc1cccc(Br)n1)C(=O)NCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H18BrN3O2/c20-18-6-3-5-16(23-18)12-15(13-21)19(25)22-11-2-1-4-14-7-9-17(24)10-8-14/h3,5-10,12,24H,1-2,4,11H2,(H,22,25) |
| InChIKey | NVHPQUDERLCNLT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|