C27H31BrN4O8 — CID 87170037
2-[2-[2-[4-[4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethoxy]ethoxy]ethyl-carboxycarbamic acid (PubChem CID 87170037) has the molecular formula C27H31BrN4O8 and a molecular weight of 619.47 g/mol. Its IUPAC name is 2-[2-[2-[4-[4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethoxy]ethoxy]ethyl-carboxycarbamic acid.
| Compound Name | 2-[2-[2-[4-[4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethoxy]ethoxy]ethyl-carboxycarbamic acid |
|---|---|
| PubChem CID | 87170037 |
| Molecular Formula | C27H31BrN4O8 |
| Molecular Weight | 619.47 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 2-[2-[2-[4-[4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethoxy]ethoxy]ethyl-carboxycarbamic acid |
| SMILES | N#C/C(=C\c1cccc(Br)n1)C(=O)NCCCCc1ccc(OCCOCCOCCN(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C27H31BrN4O8/c28-24-6-3-5-22(31-24)18-21(19-29)25(33)30-11-2-1-4-20-7-9-23(10-8-20)40-17-16-39-15-14-38-13-12-32(26(34)35)27(36)37/h3,5-10,18H,1-2,4,11-17H2,(H,30,33)(H,34,35)(H,36,37)/b21-18+ |
| InChIKey | KJKCFTPGXMBCLS-DYTRJAOYSA-N |
| XLogP | 3.96 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|