C16H20BrN3O6 — CID 88866429
(E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methoxyhexyl]prop-2-enamide (PubChem CID 88866429) has the molecular formula C16H20BrN3O6 and a molecular weight of 430.26 g/mol. Its IUPAC name is (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methoxyhexyl]prop-2-enamide.
| Compound Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methoxyhexyl]prop-2-enamide |
|---|---|
| PubChem CID | 88866429 |
| Molecular Formula | C16H20BrN3O6 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methoxyhexyl]prop-2-enamide |
| SMILES | CO[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CCNC(=O)/C(C#N)=C/c1cccc(Br)n1 |
| InChI | InChI=1S/C16H20BrN3O6/c1-26-16(25)14(23)13(22)11(21)5-6-19-15(24)9(8-18)7-10-3-2-4-12(17)20-10/h2-4,7,11,13-14,16,21-23,25H,5-6H2,1H3,(H,19,24)/b9-7+/t11-,13-,14+,16-/m0/s1 |
| InChIKey | CMPSHNMEOJNRIQ-MBGSAGEUSA-N |
| XLogP | -0.70 |
| TPSA | 155.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|