C23H23BrN4O5 — CID 156654172
2-[2-[4-[1-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethylideneamino]oxyacetic acid (PubChem CID 156654172) has the molecular formula C23H23BrN4O5 and a molecular weight of 515.36 g/mol. Its IUPAC name is 2-[2-[4-[1-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethylideneamino]oxyacetic acid.
| Compound Name | 2-[2-[4-[1-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 156654172 |
| Molecular Formula | C23H23BrN4O5 |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 2-[2-[4-[1-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]butyl]phenoxy]ethylideneamino]oxyacetic acid |
| SMILES | CCCC(NC(=O)/C(C#N)=C/c1cccc(Br)n1)c1ccc(OCC=NOCC(=O)O)cc1 |
| InChI | InChI=1S/C23H23BrN4O5/c1-2-4-20(28-23(31)17(14-25)13-18-5-3-6-21(24)27-18)16-7-9-19(10-8-16)32-12-11-26-33-15-22(29)30/h3,5-11,13,20H,2,4,12,15H2,1H3,(H,28,31)(H,29,30)/b17-13+,26-11? |
| InChIKey | YBQANBRUXJEZKS-MFCRSIBDSA-N |
| XLogP | 3.87 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|