C20H18BrN3O3 — CID 89014726
methyl (4S)-4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-4-phenylbutanoate (PubChem CID 89014726) has the molecular formula C20H18BrN3O3 and a molecular weight of 428.29 g/mol. Its IUPAC name is methyl (4S)-4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-4-phenylbutanoate.
| Compound Name | methyl (4S)-4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 89014726 |
| Molecular Formula | C20H18BrN3O3 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | methyl (4S)-4-[[(E)-3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoyl]amino]-4-phenylbutanoate |
| SMILES | COC(=O)CC[C@H](NC(=O)/C(C#N)=C/c1cccc(Br)n1)c1ccccc1 |
| InChI | InChI=1S/C20H18BrN3O3/c1-27-19(25)11-10-17(14-6-3-2-4-7-14)24-20(26)15(13-22)12-16-8-5-9-18(21)23-16/h2-9,12,17H,10-11H2,1H3,(H,24,26)/b15-12+/t17-/m0/s1 |
| InChIKey | NRQOKUFZQXKTND-VMEIHUARSA-N |
| XLogP | 3.56 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|