C21H22BrN3OS — CID 157496918
(E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(S)-cyclopentyl(phenyl)methyl]prop-2-enamide;sulfane (PubChem CID 157496918) has the molecular formula C21H22BrN3OS and a molecular weight of 444.40 g/mol. Its IUPAC name is (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(S)-cyclopentyl(phenyl)methyl]prop-2-enamide;sulfane.
| Compound Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(S)-cyclopentyl(phenyl)methyl]prop-2-enamide;sulfane |
|---|---|
| PubChem CID | 157496918 |
| Molecular Formula | C21H22BrN3OS |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(S)-cyclopentyl(phenyl)methyl]prop-2-enamide;sulfane |
| SMILES | N#C/C(=C\c1cccc(Br)n1)C(=O)N[C@H](c1ccccc1)C1CCCC1.S |
| InChI | InChI=1S/C21H20BrN3O.H2S/c22-19-12-6-11-18(24-19)13-17(14-23)21(26)25-20(16-9-4-5-10-16)15-7-2-1-3-8-15;/h1-3,6-8,11-13,16,20H,4-5,9-10H2,(H,25,26);1H2/b17-13+;/t20-;/m1./s1 |
| InChIKey | BXYFPPLMJHNZMK-VWLYRQFVSA-N |
| XLogP | 4.91 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|