C19H15BrN2O2 — CID 123618976
[cyclopropyl(phenyl)methyl] 3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoate (PubChem CID 123618976) has the molecular formula C19H15BrN2O2 and a molecular weight of 383.25 g/mol. Its IUPAC name is [cyclopropyl(phenyl)methyl] 3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoate.
| Compound Name | [cyclopropyl(phenyl)methyl] 3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 123618976 |
| Molecular Formula | C19H15BrN2O2 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [cyclopropyl(phenyl)methyl] 3-(6-bromo-2-pyridinyl)-2-cyanoprop-2-enoate |
| SMILES | N#CC(=Cc1cccc(Br)n1)C(=O)OC(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C19H15BrN2O2/c20-17-8-4-7-16(22-17)11-15(12-21)19(23)24-18(14-9-10-14)13-5-2-1-3-6-13/h1-8,11,14,18H,9-10H2 |
| InChIKey | JWPUVJDHMHUFAS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|