C16H22N2OS — CID 6031417
(E)-2-cyano-N-octyl-3-thiophen-3-ylprop-2-enamide (PubChem CID 6031417) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is (E)-2-cyano-N-octyl-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-octyl-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 6031417 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (E)-2-cyano-N-octyl-3-thiophen-3-ylprop-2-enamide |
| SMILES | CCCCCCCCNC(=O)/C(C#N)=C/c1ccsc1 |
| InChI | InChI=1S/C16H22N2OS/c1-2-3-4-5-6-7-9-18-16(19)15(12-17)11-14-8-10-20-13-14/h8,10-11,13H,2-7,9H2,1H3,(H,18,19)/b15-11+ |
| InChIKey | FMAHYDRPOUQESS-RVDMUPIBSA-N |
| XLogP | 4.13 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|