C11H17N3OS — CID 171624051
4-(1-methylimino-1-oxo-1,4-thiazinan-4-yl)aniline (PubChem CID 171624051) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-(1-methylimino-1-oxo-1,4-thiazinan-4-yl)aniline.
| Compound Name | 4-(1-methylimino-1-oxo-1,4-thiazinan-4-yl)aniline |
|---|---|
| PubChem CID | 171624051 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(1-methylimino-1-oxo-1,4-thiazinan-4-yl)aniline |
| SMILES | CN=S1(=O)CCN(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C11H17N3OS/c1-13-16(15)8-6-14(7-9-16)11-4-2-10(12)3-5-11/h2-5H,6-9,12H2,1H3 |
| InChIKey | PAAQXAKIJSNKLG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|