C11H14FN3OS — CID 59154836
1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-methylsulfanylbenzene (PubChem CID 59154836) has the molecular formula C11H14FN3OS and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-methylsulfanylbenzene.
| Compound Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 59154836 |
| Molecular Formula | C11H14FN3OS |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-methylsulfanylbenzene |
| SMILES | CO[C@H](c1ccc(SC)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C11H14FN3OS/c1-16-11(10(7-12)14-15-13)8-3-5-9(17-2)6-4-8/h3-6,10-11H,7H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | ZWYGKTGWKQCKFP-GHMZBOCLSA-N |
| XLogP | 3.74 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|