C11H13F2N3O3S — CID 59154817
1-[(1R,2S)-2-azido-3-fluoro-1-(fluoromethoxy)propyl]-4-methylsulfonylbenzene (PubChem CID 59154817) has the molecular formula C11H13F2N3O3S and a molecular weight of 305.31 g/mol. Its IUPAC name is 1-[(1R,2S)-2-azido-3-fluoro-1-(fluoromethoxy)propyl]-4-methylsulfonylbenzene.
| Compound Name | 1-[(1R,2S)-2-azido-3-fluoro-1-(fluoromethoxy)propyl]-4-methylsulfonylbenzene |
|---|---|
| PubChem CID | 59154817 |
| Molecular Formula | C11H13F2N3O3S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-[(1R,2S)-2-azido-3-fluoro-1-(fluoromethoxy)propyl]-4-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1ccc([C@@H](OCF)[C@@H](CF)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C11H13F2N3O3S/c1-20(17,18)9-4-2-8(3-5-9)11(19-7-13)10(6-12)15-16-14/h2-5,10-11H,6-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | XHVUVOFXKVYFED-GHMZBOCLSA-N |
| XLogP | 2.72 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|