C9H9N7O2 — CID 11586833
1-(1,3-diazidopropyl)-4-nitrobenzene (PubChem CID 11586833) has the molecular formula C9H9N7O2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 1-(1,3-diazidopropyl)-4-nitrobenzene.
| Compound Name | 1-(1,3-diazidopropyl)-4-nitrobenzene |
|---|---|
| PubChem CID | 11586833 |
| Molecular Formula | C9H9N7O2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(1,3-diazidopropyl)-4-nitrobenzene |
| SMILES | [N-]=[N+]=NCCC(N=[N+]=[N-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H9N7O2/c10-14-12-6-5-9(13-15-11)7-1-3-8(4-2-7)16(17)18/h1-4,9H,5-6H2 |
| InChIKey | MQAACCLBUTUSHX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 140.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|