C9H10N6 — CID 22555830
1-(1,2-diazidoethyl)-4-methylbenzene (PubChem CID 22555830) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is 1-(1,2-diazidoethyl)-4-methylbenzene.
| Compound Name | 1-(1,2-diazidoethyl)-4-methylbenzene |
|---|---|
| PubChem CID | 22555830 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1-(1,2-diazidoethyl)-4-methylbenzene |
| SMILES | Cc1ccc(C(CN=[N+]=[N-])N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C9H10N6/c1-7-2-4-8(5-3-7)9(13-15-11)6-12-14-10/h2-5,9H,6H2,1H3 |
| InChIKey | GMNGLCJPWCDVNJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|