C15H14N6 — CID 173489253
[(1R)-1,3-diazido-3-phenylpropyl]benzene (PubChem CID 173489253) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is [(1R)-1,3-diazido-3-phenylpropyl]benzene.
| Compound Name | [(1R)-1,3-diazido-3-phenylpropyl]benzene |
|---|---|
| PubChem CID | 173489253 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(1R)-1,3-diazido-3-phenylpropyl]benzene |
| SMILES | [N-]=[N+]=NC(C[C@@H](N=[N+]=[N-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14N6/c16-20-18-14(12-7-3-1-4-8-12)11-15(19-21-17)13-9-5-2-6-10-13/h1-10,14-15H,11H2/t14-,15?/m1/s1 |
| InChIKey | YEBRGEJEELPMQG-GICMACPYSA-N |
| XLogP | 5.48 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|