About 1-azidoethylbenzene;rutherfordium
1-azidoethylbenzene;rutherfordium (PubChem CID 164682977) has the molecular formula C8H8N3Rf-
and a molecular weight of 413.17 g/mol. Its IUPAC name is 1-azidoethylbenzene;rutherfordium.
Molecular Properties
| Compound Name | 1-azidoethylbenzene;rutherfordium |
| PubChem CID | 164682977 |
| Molecular Formula | C8H8N3Rf- |
| Molecular Weight | 413.17 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-azidoethylbenzene;rutherfordium |
| SMILES | [CH2-]C(N=[N+]=[N-])c1ccccc1.[Rf] |
| InChI | InChI=1S/C8H8N3.Rf/c1-7(10-11-9)8-5-3-2-4-6-8;/h2-7H,1H2;/q-1; |
| InChIKey | PBIOZVSUQAWECD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azidoethylbenzene;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidoethylbenzene;rutherfordium?
The IUPAC name of 1-azidoethylbenzene;rutherfordium (CID 164682977) is 1-azidoethylbenzene;rutherfordium.
What is the SMILES notation for 1-azidoethylbenzene;rutherfordium?
The canonical SMILES for 1-azidoethylbenzene;rutherfordium is [CH2-]C(N=[N+]=[N-])c1ccccc1.[Rf].
What is the InChIKey of 1-azidoethylbenzene;rutherfordium?
The InChIKey is PBIOZVSUQAWECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N3.Rf/c1-7(10-11-9)8-5-3-2-4-6-8;/h2-7H,1H2;/q-1;.
What are the key properties of 1-azidoethylbenzene;rutherfordium?
1-azidoethylbenzene;rutherfordium has a molecular weight of 413.17 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidoethylbenzene;rutherfordium is sourced from PubChem (CID 164682977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).