About azido(phenyl)methanethiolate;neodymium;tritiophosphane
azido(phenyl)methanethiolate;neodymium;tritiophosphane (PubChem CID 59611950) has the molecular formula C7H9N3NdPS-
and a molecular weight of 344.46 g/mol. Its IUPAC name is azido(phenyl)methanethiolate;neodymium;tritiophosphane.
Molecular Properties
| Compound Name | azido(phenyl)methanethiolate;neodymium;tritiophosphane |
| PubChem CID | 59611950 |
| Molecular Formula | C7H9N3NdPS- |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | azido(phenyl)methanethiolate;neodymium;tritiophosphane |
| SMILES | [3H]P.[N-]=[N+]=NC([S-])c1ccccc1.[Nd] |
| InChI | InChI=1S/C7H7N3S.Nd.H3P/c8-10-9-7(11)6-4-2-1-3-5-6;;/h1-5,7,11H;;1H3/p-1/i;;1T |
| InChIKey | UAQDNWUZDFOUPY-ZDNREJLISA-M |
| XLogP | 2.60 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azido(phenyl)methanethiolate;neodymium;tritiophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido(phenyl)methanethiolate;neodymium;tritiophosphane?
The IUPAC name of azido(phenyl)methanethiolate;neodymium;tritiophosphane (CID 59611950) is azido(phenyl)methanethiolate;neodymium;tritiophosphane.
What is the SMILES notation for azido(phenyl)methanethiolate;neodymium;tritiophosphane?
The canonical SMILES for azido(phenyl)methanethiolate;neodymium;tritiophosphane is [3H]P.[N-]=[N+]=NC([S-])c1ccccc1.[Nd].
What is the InChIKey of azido(phenyl)methanethiolate;neodymium;tritiophosphane?
The InChIKey is UAQDNWUZDFOUPY-ZDNREJLISA-M. The full InChI is InChI=1S/C7H7N3S.Nd.H3P/c8-10-9-7(11)6-4-2-1-3-5-6;;/h1-5,7,11H;;1H3/p-1/i;;1T.
What are the key properties of azido(phenyl)methanethiolate;neodymium;tritiophosphane?
azido(phenyl)methanethiolate;neodymium;tritiophosphane has a molecular weight of 344.46 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azido(phenyl)methanethiolate;neodymium;tritiophosphane is sourced from PubChem (CID 59611950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).