About azido(phenyl)methanol
azido(phenyl)methanol (PubChem CID 59611949) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is azido(phenyl)methanol.
Molecular Properties
| Compound Name | azido(phenyl)methanol |
| PubChem CID | 59611949 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | azido(phenyl)methanol |
| SMILES | [N-]=[N+]=NC(O)c1ccccc1 |
| InChI | InChI=1S/C7H7N3O/c8-10-9-7(11)6-4-2-1-3-5-6/h1-5,7,11H |
| InChIKey | RXWGKZMNACHQDD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azido(phenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido(phenyl)methanol?
The IUPAC name of azido(phenyl)methanol (CID 59611949) is azido(phenyl)methanol.
What is the SMILES notation for azido(phenyl)methanol?
The canonical SMILES for azido(phenyl)methanol is [N-]=[N+]=NC(O)c1ccccc1.
What is the InChIKey of azido(phenyl)methanol?
The InChIKey is RXWGKZMNACHQDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-10-9-7(11)6-4-2-1-3-5-6/h1-5,7,11H.
What are the key properties of azido(phenyl)methanol?
azido(phenyl)methanol has a molecular weight of 149.15 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azido(phenyl)methanol is sourced from PubChem (CID 59611949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).