C13H13N3O — CID 12014849
(1R,2R)-2-azido-2-cyclopenta-2,4-dien-1-yl-1-phenylethanol (PubChem CID 12014849) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is (1R,2R)-2-azido-2-cyclopenta-2,4-dien-1-yl-1-phenylethanol.
| Compound Name | (1R,2R)-2-azido-2-cyclopenta-2,4-dien-1-yl-1-phenylethanol |
|---|---|
| PubChem CID | 12014849 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1R,2R)-2-azido-2-cyclopenta-2,4-dien-1-yl-1-phenylethanol |
| SMILES | [N-]=[N+]=N[C@H](C1C=CC=C1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O/c14-16-15-12(10-6-4-5-7-10)13(17)11-8-2-1-3-9-11/h1-10,12-13,17H/t12-,13-/m1/s1 |
| InChIKey | FYWLYCYUIRWQCY-CHWSQXEVSA-N |
| XLogP | 3.14 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|