C10H11N3O3 — CID 15138856
methyl (2S,3R)-2-azido-3-hydroxy-3-phenylpropanoate (PubChem CID 15138856) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is methyl (2S,3R)-2-azido-3-hydroxy-3-phenylpropanoate.
| Compound Name | methyl (2S,3R)-2-azido-3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 15138856 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | methyl (2S,3R)-2-azido-3-hydroxy-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](N=[N+]=[N-])[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H11N3O3/c1-16-10(15)8(12-13-11)9(14)7-5-3-2-4-6-7/h2-6,8-9,14H,1H3/t8-,9+/m0/s1 |
| InChIKey | OWOFSTZBLZMVEP-DTWKUNHWSA-N |
| XLogP | 1.57 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|