C16H16N4O2 — CID 100913762
N-[4-[(1R,2S)-2-azido-1-hydroxy-2-phenylethyl]phenyl]acetamide (PubChem CID 100913762) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[4-[(1R,2S)-2-azido-1-hydroxy-2-phenylethyl]phenyl]acetamide.
| Compound Name | N-[4-[(1R,2S)-2-azido-1-hydroxy-2-phenylethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 100913762 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-[4-[(1R,2S)-2-azido-1-hydroxy-2-phenylethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@@H](O)[C@@H](N=[N+]=[N-])c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N4O2/c1-11(21)18-14-9-7-13(8-10-14)16(22)15(19-20-17)12-5-3-2-4-6-12/h2-10,15-16,22H,1H3,(H,18,21)/t15-,16+/m0/s1 |
| InChIKey | IWMJHWZGSYGCCX-JKSUJKDBSA-N |
| XLogP | 3.73 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|